C26H44O8 — CID 88825288
2-[[1-[1,3-bis(oxiran-2-ylmethoxy)octyl]-4-(oxiran-2-ylmethoxy)cyclohexyl]oxymethyl]oxirane (PubChem CID 88825288) has the molecular formula C26H44O8 and a molecular weight of 484.63 g/mol. Its IUPAC name is 2-[[1-[1,3-bis(oxiran-2-ylmethoxy)octyl]-4-(oxiran-2-ylmethoxy)cyclohexyl]oxymethyl]oxirane.
| Compound Name | 2-[[1-[1,3-bis(oxiran-2-ylmethoxy)octyl]-4-(oxiran-2-ylmethoxy)cyclohexyl]oxymethyl]oxirane |
|---|---|
| PubChem CID | 88825288 |
| Molecular Formula | C26H44O8 |
| Molecular Weight | 484.63 g/mol |
| Exact Mass | 484.30 |
| IUPAC Name | 2-[[1-[1,3-bis(oxiran-2-ylmethoxy)octyl]-4-(oxiran-2-ylmethoxy)cyclohexyl]oxymethyl]oxirane |
| SMILES | CCCCCC(CC(OCC1CO1)C1(OCC2CO2)CCC(OCC2CO2)CC1)OCC1CO1 |
| InChI | InChI=1S/C26H44O8/c1-2-3-4-5-20(28-12-22-14-30-22)10-25(33-17-23-15-31-23)26(34-18-24-16-32-24)8-6-19(7-9-26)27-11-21-13-29-21/h19-25H,2-18H2,1H3 |
| InChIKey | MCILOFXJWXYUNB-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 87.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.63 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|