About 4-cyclopenta-2,4-dien-1-yl-2-methyl-4-oxobutanoic acid;cyclopentane;iron
4-cyclopenta-2,4-dien-1-yl-2-methyl-4-oxobutanoic acid;cyclopentane;iron (PubChem CID 88825601) has the molecular formula C15H16FeO3-6
and a molecular weight of 300.14 g/mol. Its IUPAC name is 4-cyclopenta-2,4-dien-1-yl-2-methyl-4-oxobutanoic acid;cyclopentane;iron.
Molecular Properties
| Compound Name | 4-cyclopenta-2,4-dien-1-yl-2-methyl-4-oxobutanoic acid;cyclopentane;iron |
| PubChem CID | 88825601 |
| Molecular Formula | C15H16FeO3-6 |
| Molecular Weight | 300.14 g/mol |
| Exact Mass | 300.05 |
| IUPAC Name | 4-cyclopenta-2,4-dien-1-yl-2-methyl-4-oxobutanoic acid;cyclopentane;iron |
| SMILES | CC(CC(=O)[c-]1cccc1)C(=O)O.[Fe].[cH-]1[cH-][cH-][cH-][cH-]1 |
| InChI | InChI=1S/C10H11O3.C5H5.Fe/c1-7(10(12)13)6-9(11)8-4-2-3-5-8;1-2-4-5-3-1;/h2-5,7H,6H2,1H3,(H,12,13);1-5H;/q-1;-5; |
| InChIKey | ODEAZCBVTDSXRV-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.14 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 4-cyclopenta-2,4-dien-1-yl-2-methyl-4-oxobutanoic acid;cyclopentane;iron with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-cyclopenta-2,4-dien-1-yl-2-methyl-4-oxobutanoic acid;cyclopentane;iron?
The IUPAC name of 4-cyclopenta-2,4-dien-1-yl-2-methyl-4-oxobutanoic acid;cyclopentane;iron (CID 88825601) is 4-cyclopenta-2,4-dien-1-yl-2-methyl-4-oxobutanoic acid;cyclopentane;iron.
What is the SMILES notation for 4-cyclopenta-2,4-dien-1-yl-2-methyl-4-oxobutanoic acid;cyclopentane;iron?
The canonical SMILES for 4-cyclopenta-2,4-dien-1-yl-2-methyl-4-oxobutanoic acid;cyclopentane;iron is CC(CC(=O)[c-]1cccc1)C(=O)O.[Fe].[cH-]1[cH-][cH-][cH-][cH-]1.
What is the InChIKey of 4-cyclopenta-2,4-dien-1-yl-2-methyl-4-oxobutanoic acid;cyclopentane;iron?
The InChIKey is ODEAZCBVTDSXRV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11O3.C5H5.Fe/c1-7(10(12)13)6-9(11)8-4-2-3-5-8;1-2-4-5-3-1;/h2-5,7H,6H2,1H3,(H,12,13);1-5H;/q-1;-5;.
What are the key properties of 4-cyclopenta-2,4-dien-1-yl-2-methyl-4-oxobutanoic acid;cyclopentane;iron?
4-cyclopenta-2,4-dien-1-yl-2-methyl-4-oxobutanoic acid;cyclopentane;iron has a molecular weight of 300.14 g/mol, XLogP of 3.10, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-cyclopenta-2,4-dien-1-yl-2-methyl-4-oxobutanoic acid;cyclopentane;iron is sourced from PubChem (CID 88825601), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).