About 3-iodopropyl 2-nitro-2-(1,3-thiazinan-2-ylidene)acetate
3-iodopropyl 2-nitro-2-(1,3-thiazinan-2-ylidene)acetate (PubChem CID 88825605) has the molecular formula C9H13IN2O4S
and a molecular weight of 372.18 g/mol. Its IUPAC name is 3-iodopropyl 2-nitro-2-(1,3-thiazinan-2-ylidene)acetate.
Molecular Properties
| Compound Name | 3-iodopropyl 2-nitro-2-(1,3-thiazinan-2-ylidene)acetate |
| PubChem CID | 88825605 |
| Molecular Formula | C9H13IN2O4S |
| Molecular Weight | 372.18 g/mol |
| Exact Mass | 371.96 |
| IUPAC Name | 3-iodopropyl 2-nitro-2-(1,3-thiazinan-2-ylidene)acetate |
| SMILES | O=C(OCCCI)C(=C1NCCCS1)[N+](=O)[O-] |
| InChI | InChI=1S/C9H13IN2O4S/c10-3-1-5-16-9(13)7(12(14)15)8-11-4-2-6-17-8/h11H,1-6H2 |
| InChIKey | HPQVXAUQPVZDDJ-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 372.18 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|
Analyze 3-iodopropyl 2-nitro-2-(1,3-thiazinan-2-ylidene)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-iodopropyl 2-nitro-2-(1,3-thiazinan-2-ylidene)acetate?
The IUPAC name of 3-iodopropyl 2-nitro-2-(1,3-thiazinan-2-ylidene)acetate (CID 88825605) is 3-iodopropyl 2-nitro-2-(1,3-thiazinan-2-ylidene)acetate.
What is the SMILES notation for 3-iodopropyl 2-nitro-2-(1,3-thiazinan-2-ylidene)acetate?
The canonical SMILES for 3-iodopropyl 2-nitro-2-(1,3-thiazinan-2-ylidene)acetate is O=C(OCCCI)C(=C1NCCCS1)[N+](=O)[O-].
What is the InChIKey of 3-iodopropyl 2-nitro-2-(1,3-thiazinan-2-ylidene)acetate?
The InChIKey is HPQVXAUQPVZDDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13IN2O4S/c10-3-1-5-16-9(13)7(12(14)15)8-11-4-2-6-17-8/h11H,1-6H2.
What are the key properties of 3-iodopropyl 2-nitro-2-(1,3-thiazinan-2-ylidene)acetate?
3-iodopropyl 2-nitro-2-(1,3-thiazinan-2-ylidene)acetate has a molecular weight of 372.18 g/mol, XLogP of 1.53, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-iodopropyl 2-nitro-2-(1,3-thiazinan-2-ylidene)acetate is sourced from PubChem (CID 88825605), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).