About iodo-methyl-triphenyl-λ5-stibane
iodo-methyl-triphenyl-λ5-stibane (PubChem CID 88825659) has the molecular formula C19H18ISb
and a molecular weight of 495.02 g/mol. Its IUPAC name is iodo-methyl-triphenyl-λ5-stibane.
Molecular Properties
| Compound Name | iodo-methyl-triphenyl-λ5-stibane |
| PubChem CID | 88825659 |
| Molecular Formula | C19H18ISb |
| Molecular Weight | 495.02 g/mol |
| Exact Mass | 493.95 |
| IUPAC Name | iodo-methyl-triphenyl-λ5-stibane |
| SMILES | C[Sb](I)(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/3C6H5.CH3.HI.Sb/c3*1-2-4-6-5-3-1;;;/h3*1-5H;1H3;1H;/q;;;;;+1/p-1 |
| InChIKey | YPSAHAJFUHDNGP-UHFFFAOYSA-M |
| XLogP | 3.67 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 495.02 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze iodo-methyl-triphenyl-λ5-stibane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of iodo-methyl-triphenyl-λ5-stibane?
The IUPAC name of iodo-methyl-triphenyl-λ5-stibane (CID 88825659) is iodo-methyl-triphenyl-λ5-stibane.
What is the SMILES notation for iodo-methyl-triphenyl-λ5-stibane?
The canonical SMILES for iodo-methyl-triphenyl-λ5-stibane is C[Sb](I)(c1ccccc1)(c1ccccc1)c1ccccc1.
What is the InChIKey of iodo-methyl-triphenyl-λ5-stibane?
The InChIKey is YPSAHAJFUHDNGP-UHFFFAOYSA-M. The full InChI is InChI=1S/3C6H5.CH3.HI.Sb/c3*1-2-4-6-5-3-1;;;/h3*1-5H;1H3;1H;/q;;;;;+1/p-1.
What are the key properties of iodo-methyl-triphenyl-λ5-stibane?
iodo-methyl-triphenyl-λ5-stibane has a molecular weight of 495.02 g/mol, XLogP of 3.67, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for iodo-methyl-triphenyl-λ5-stibane is sourced from PubChem (CID 88825659), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).