C27H22F12N4O11 — CID 88825730
bis[2-(2-butan-2-yl-4,6-dinitrophenyl)-1,1,1,3,3,3-hexafluoropropan-2-yl] carbonate (PubChem CID 88825730) has the molecular formula C27H22F12N4O11 and a molecular weight of 806.47 g/mol. Its IUPAC name is bis[2-(2-butan-2-yl-4,6-dinitrophenyl)-1,1,1,3,3,3-hexafluoropropan-2-yl] carbonate.
| Compound Name | bis[2-(2-butan-2-yl-4,6-dinitrophenyl)-1,1,1,3,3,3-hexafluoropropan-2-yl] carbonate |
|---|---|
| PubChem CID | 88825730 |
| Molecular Formula | C27H22F12N4O11 |
| Molecular Weight | 806.47 g/mol |
| Exact Mass | 806.11 |
| IUPAC Name | bis[2-(2-butan-2-yl-4,6-dinitrophenyl)-1,1,1,3,3,3-hexafluoropropan-2-yl] carbonate |
| SMILES | CCC(C)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1C(OC(=O)OC(c1c(C(C)CC)cc([N+](=O)[O-])cc1[N+](=O)[O-])(C(F)(F)F)C(F)(F)F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C27H22F12N4O11/c1-5-11(3)15-7-13(40(45)46)9-17(42(49)50)19(15)22(24(28,29)30,25(31,32)33)53-21(44)54-23(26(34,35)36,27(37,38)39)20-16(12(4)6-2)8-14(41(47)48)10-18(20)43(51)52/h7-12H,5-6H2,1-4H3 |
| InChIKey | ZNRXBLJCYOYBKZ-UHFFFAOYSA-N |
| XLogP | 9.84 |
| TPSA | 208.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 806.47 |
| LogP ≤ 5 | 9.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|