C13H19NO5 — CID 88825785
2,2-dimethyl-5-[4-(prop-2-enoxyamino)butylidene]-1,3-dioxane-4,6-dione (PubChem CID 88825785) has the molecular formula C13H19NO5 and a molecular weight of 269.30 g/mol. Its IUPAC name is 2,2-dimethyl-5-[4-(prop-2-enoxyamino)butylidene]-1,3-dioxane-4,6-dione.
| Compound Name | 2,2-dimethyl-5-[4-(prop-2-enoxyamino)butylidene]-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 88825785 |
| Molecular Formula | C13H19NO5 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.13 |
| IUPAC Name | 2,2-dimethyl-5-[4-(prop-2-enoxyamino)butylidene]-1,3-dioxane-4,6-dione |
| SMILES | C=CCONCCCC=C1C(=O)OC(C)(C)OC1=O |
| InChI | InChI=1S/C13H19NO5/c1-4-9-17-14-8-6-5-7-10-11(15)18-13(2,3)19-12(10)16/h4,7,14H,1,5-6,8-9H2,2-3H3 |
| InChIKey | JGXDHGONPCMTOD-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|