C12H22N6OS2 — CID 88825899
S-[2-[[4-methylsulfanyl-6-(propan-2-ylamino)-1,3,5-triazin-2-yl]amino]ethyl] N,N-dimethylcarbamothioate (PubChem CID 88825899) has the molecular formula C12H22N6OS2 and a molecular weight of 330.48 g/mol. Its IUPAC name is S-[2-[[4-methylsulfanyl-6-(propan-2-ylamino)-1,3,5-triazin-2-yl]amino]ethyl] N,N-dimethylcarbamothioate.
| Compound Name | S-[2-[[4-methylsulfanyl-6-(propan-2-ylamino)-1,3,5-triazin-2-yl]amino]ethyl] N,N-dimethylcarbamothioate |
|---|---|
| PubChem CID | 88825899 |
| Molecular Formula | C12H22N6OS2 |
| Molecular Weight | 330.48 g/mol |
| Exact Mass | 330.13 |
| IUPAC Name | S-[2-[[4-methylsulfanyl-6-(propan-2-ylamino)-1,3,5-triazin-2-yl]amino]ethyl] N,N-dimethylcarbamothioate |
| SMILES | CSc1nc(NCCSC(=O)N(C)C)nc(NC(C)C)n1 |
| InChI | InChI=1S/C12H22N6OS2/c1-8(2)14-10-15-9(16-11(17-10)20-5)13-6-7-21-12(19)18(3)4/h8H,6-7H2,1-5H3,(H2,13,14,15,16,17) |
| InChIKey | LWODPCDXNXPRKC-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 83.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.48 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|