C11H4F6O4 — CID 88825954
5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-benzofuran-1,3-dione (PubChem CID 88825954) has the molecular formula C11H4F6O4 and a molecular weight of 314.14 g/mol. Its IUPAC name is 5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-benzofuran-1,3-dione.
| Compound Name | 5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-benzofuran-1,3-dione |
|---|---|
| PubChem CID | 88825954 |
| Molecular Formula | C11H4F6O4 |
| Molecular Weight | 314.14 g/mol |
| Exact Mass | 314.00 |
| IUPAC Name | 5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-benzofuran-1,3-dione |
| SMILES | O=C1OC(=O)c2cc(C(O)(C(F)(F)F)C(F)(F)F)ccc21 |
| InChI | InChI=1S/C11H4F6O4/c12-10(13,14)9(20,11(15,16)17)4-1-2-5-6(3-4)8(19)21-7(5)18/h1-3,20H |
| InChIKey | CJVPKWBKEFUAMR-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.14 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|