C11H13ClN2O3 — CID 88825961
N'-hydroxy-3,4-dimethoxybicyclo[4.2.0]octa-1,3,5,7-tetraene-7-carboximidamide;hydrochloride (PubChem CID 88825961) has the molecular formula C11H13ClN2O3 and a molecular weight of 256.69 g/mol. Its IUPAC name is N'-hydroxy-3,4-dimethoxybicyclo[4.2.0]octa-1,3,5,7-tetraene-7-carboximidamide;hydrochloride.
| Compound Name | N'-hydroxy-3,4-dimethoxybicyclo[4.2.0]octa-1,3,5,7-tetraene-7-carboximidamide;hydrochloride |
|---|---|
| PubChem CID | 88825961 |
| Molecular Formula | C11H13ClN2O3 |
| Molecular Weight | 256.69 g/mol |
| Exact Mass | 256.06 |
| IUPAC Name | N'-hydroxy-3,4-dimethoxybicyclo[4.2.0]octa-1,3,5,7-tetraene-7-carboximidamide;hydrochloride |
| SMILES | COc1cc2c(cc1OC)C(C(N)=NO)=C2.Cl |
| InChI | InChI=1S/C11H12N2O3.ClH/c1-15-9-4-6-3-8(11(12)13-14)7(6)5-10(9)16-2;/h3-5,14H,1-2H3,(H2,12,13);1H |
| InChIKey | MLYHVTAYEDEWOF-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 77.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.69 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|