C26H36O3 — CID 88826033
1-[(9S,10S,13R,17S)-10-(hydroxymethyl)-13-methyl-9,11,12,15,16,17-hexahydro-1H-cyclopenta[a]phenanthren-17-yl]ethyl 2,2-dimethylpropanoate (PubChem CID 88826033) has the molecular formula C26H36O3 and a molecular weight of 396.57 g/mol. Its IUPAC name is 1-[(9S,10S,13R,17S)-10-(hydroxymethyl)-13-methyl-9,11,12,15,16,17-hexahydro-1H-cyclopenta[a]phenanthren-17-yl]ethyl 2,2-dimethylpropanoate.
| Compound Name | 1-[(9S,10S,13R,17S)-10-(hydroxymethyl)-13-methyl-9,11,12,15,16,17-hexahydro-1H-cyclopenta[a]phenanthren-17-yl]ethyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 88826033 |
| Molecular Formula | C26H36O3 |
| Molecular Weight | 396.57 g/mol |
| Exact Mass | 396.27 |
| IUPAC Name | 1-[(9S,10S,13R,17S)-10-(hydroxymethyl)-13-methyl-9,11,12,15,16,17-hexahydro-1H-cyclopenta[a]phenanthren-17-yl]ethyl 2,2-dimethylpropanoate |
| SMILES | CC(OC(=O)C(C)(C)C)[C@H]1CCC2=C3C=CC4=CC=CC[C@]4(CO)[C@H]3CC[C@@]21C |
| InChI | InChI=1S/C26H36O3/c1-17(29-23(28)24(2,3)4)20-11-12-21-19-10-9-18-8-6-7-14-26(18,16-27)22(19)13-15-25(20,21)5/h6-10,17,20,22,27H,11-16H2,1-5H3/t17?,20-,22+,25-,26-/m1/s1 |
| InChIKey | AHORDIUIOVPNHN-UUEKEABQSA-N |
| XLogP | 5.52 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.57 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |