About 6-[(Z)-2-bromo-2-chloroethenyl]-1,6-dimethylcyclohexene
6-[(Z)-2-bromo-2-chloroethenyl]-1,6-dimethylcyclohexene (PubChem CID 88826043) has the molecular formula C10H14BrCl
and a molecular weight of 249.58 g/mol. Its IUPAC name is 6-[(Z)-2-bromo-2-chloroethenyl]-1,6-dimethylcyclohexene.
Molecular Properties
| Compound Name | 6-[(Z)-2-bromo-2-chloroethenyl]-1,6-dimethylcyclohexene |
| PubChem CID | 88826043 |
| Molecular Formula | C10H14BrCl |
| Molecular Weight | 249.58 g/mol |
| Exact Mass | 248.00 |
| IUPAC Name | 6-[(Z)-2-bromo-2-chloroethenyl]-1,6-dimethylcyclohexene |
| SMILES | CC1=CCCCC1(C)/C=C(/Cl)Br |
| InChI | InChI=1S/C10H14BrCl/c1-8-5-3-4-6-10(8,2)7-9(11)12/h5,7H,3-4,6H2,1-2H3/b9-7+ |
| InChIKey | JGVYSHKGMXTOCR-VQHVLOKHSA-N |
| XLogP | 4.60 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.58 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 6-[(Z)-2-bromo-2-chloroethenyl]-1,6-dimethylcyclohexene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[(Z)-2-bromo-2-chloroethenyl]-1,6-dimethylcyclohexene?
The IUPAC name of 6-[(Z)-2-bromo-2-chloroethenyl]-1,6-dimethylcyclohexene (CID 88826043) is 6-[(Z)-2-bromo-2-chloroethenyl]-1,6-dimethylcyclohexene.
What is the SMILES notation for 6-[(Z)-2-bromo-2-chloroethenyl]-1,6-dimethylcyclohexene?
The canonical SMILES for 6-[(Z)-2-bromo-2-chloroethenyl]-1,6-dimethylcyclohexene is CC1=CCCCC1(C)/C=C(/Cl)Br.
What is the InChIKey of 6-[(Z)-2-bromo-2-chloroethenyl]-1,6-dimethylcyclohexene?
The InChIKey is JGVYSHKGMXTOCR-VQHVLOKHSA-N. The full InChI is InChI=1S/C10H14BrCl/c1-8-5-3-4-6-10(8,2)7-9(11)12/h5,7H,3-4,6H2,1-2H3/b9-7+.
What are the key properties of 6-[(Z)-2-bromo-2-chloroethenyl]-1,6-dimethylcyclohexene?
6-[(Z)-2-bromo-2-chloroethenyl]-1,6-dimethylcyclohexene has a molecular weight of 249.58 g/mol, XLogP of 4.60, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[(Z)-2-bromo-2-chloroethenyl]-1,6-dimethylcyclohexene is sourced from PubChem (CID 88826043), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).