About 7-[(Z)-2-bromo-2-chloroethenyl]-1,7-dimethylcycloheptene
7-[(Z)-2-bromo-2-chloroethenyl]-1,7-dimethylcycloheptene (PubChem CID 88826192) has the molecular formula C11H16BrCl
and a molecular weight of 263.61 g/mol. Its IUPAC name is 7-[(Z)-2-bromo-2-chloroethenyl]-1,7-dimethylcycloheptene.
Molecular Properties
| Compound Name | 7-[(Z)-2-bromo-2-chloroethenyl]-1,7-dimethylcycloheptene |
| PubChem CID | 88826192 |
| Molecular Formula | C11H16BrCl |
| Molecular Weight | 263.61 g/mol |
| Exact Mass | 262.01 |
| IUPAC Name | 7-[(Z)-2-bromo-2-chloroethenyl]-1,7-dimethylcycloheptene |
| SMILES | CC1=CCCCCC1(C)/C=C(/Cl)Br |
| InChI | InChI=1S/C11H16BrCl/c1-9-6-4-3-5-7-11(9,2)8-10(12)13/h6,8H,3-5,7H2,1-2H3/b10-8+ |
| InChIKey | VQEAIJXJLAKEST-CSKARUKUSA-N |
| XLogP | 4.99 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.61 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 7-[(Z)-2-bromo-2-chloroethenyl]-1,7-dimethylcycloheptene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-[(Z)-2-bromo-2-chloroethenyl]-1,7-dimethylcycloheptene?
The IUPAC name of 7-[(Z)-2-bromo-2-chloroethenyl]-1,7-dimethylcycloheptene (CID 88826192) is 7-[(Z)-2-bromo-2-chloroethenyl]-1,7-dimethylcycloheptene.
What is the SMILES notation for 7-[(Z)-2-bromo-2-chloroethenyl]-1,7-dimethylcycloheptene?
The canonical SMILES for 7-[(Z)-2-bromo-2-chloroethenyl]-1,7-dimethylcycloheptene is CC1=CCCCCC1(C)/C=C(/Cl)Br.
What is the InChIKey of 7-[(Z)-2-bromo-2-chloroethenyl]-1,7-dimethylcycloheptene?
The InChIKey is VQEAIJXJLAKEST-CSKARUKUSA-N. The full InChI is InChI=1S/C11H16BrCl/c1-9-6-4-3-5-7-11(9,2)8-10(12)13/h6,8H,3-5,7H2,1-2H3/b10-8+.
What are the key properties of 7-[(Z)-2-bromo-2-chloroethenyl]-1,7-dimethylcycloheptene?
7-[(Z)-2-bromo-2-chloroethenyl]-1,7-dimethylcycloheptene has a molecular weight of 263.61 g/mol, XLogP of 4.99, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 7-[(Z)-2-bromo-2-chloroethenyl]-1,7-dimethylcycloheptene is sourced from PubChem (CID 88826192), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).