C21H21NO6S — CID 88826309
2-[4,5-bis(3,4-dimethoxyphenyl)-1,3-oxazol-2-yl]-2-sulfanylacetaldehyde (PubChem CID 88826309) has the molecular formula C21H21NO6S and a molecular weight of 415.47 g/mol. Its IUPAC name is 2-[4,5-bis(3,4-dimethoxyphenyl)-1,3-oxazol-2-yl]-2-sulfanylacetaldehyde.
| Compound Name | 2-[4,5-bis(3,4-dimethoxyphenyl)-1,3-oxazol-2-yl]-2-sulfanylacetaldehyde |
|---|---|
| PubChem CID | 88826309 |
| Molecular Formula | C21H21NO6S |
| Molecular Weight | 415.47 g/mol |
| Exact Mass | 415.11 |
| IUPAC Name | 2-[4,5-bis(3,4-dimethoxyphenyl)-1,3-oxazol-2-yl]-2-sulfanylacetaldehyde |
| SMILES | COc1ccc(-c2nc(C(S)C=O)oc2-c2ccc(OC)c(OC)c2)cc1OC |
| InChI | InChI=1S/C21H21NO6S/c1-24-14-7-5-12(9-16(14)26-3)19-20(28-21(22-19)18(29)11-23)13-6-8-15(25-2)17(10-13)27-4/h5-11,18,29H,1-4H3 |
| InChIKey | QKWZAXHNQFOREQ-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 80.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.47 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|