C20H26N2O4S — CID 88826325
1,2-dimethyl-3-(2-methylphenyl)-5-(4-methylphenyl)-3,4-dihydropyrazol-1-ium;methyl sulfate (PubChem CID 88826325) has the molecular formula C20H26N2O4S and a molecular weight of 390.51 g/mol. Its IUPAC name is 1,2-dimethyl-3-(2-methylphenyl)-5-(4-methylphenyl)-3,4-dihydropyrazol-1-ium;methyl sulfate.
| Compound Name | 1,2-dimethyl-3-(2-methylphenyl)-5-(4-methylphenyl)-3,4-dihydropyrazol-1-ium;methyl sulfate |
|---|---|
| PubChem CID | 88826325 |
| Molecular Formula | C20H26N2O4S |
| Molecular Weight | 390.51 g/mol |
| Exact Mass | 390.16 |
| IUPAC Name | 1,2-dimethyl-3-(2-methylphenyl)-5-(4-methylphenyl)-3,4-dihydropyrazol-1-ium;methyl sulfate |
| SMILES | COS(=O)(=O)[O-].Cc1ccc(C2=[N+](C)N(C)C(c3ccccc3C)C2)cc1 |
| InChI | InChI=1S/C19H23N2.CH4O4S/c1-14-9-11-16(12-10-14)18-13-19(21(4)20(18)3)17-8-6-5-7-15(17)2;1-5-6(2,3)4/h5-12,19H,13H2,1-4H3;1H3,(H,2,3,4)/q+1;/p-1 |
| InChIKey | OGFZIKQPDMNCHV-UHFFFAOYSA-M |
| XLogP | 2.82 |
| TPSA | 72.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.51 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|