About 2-cyanosulfinylacetic acid
2-cyanosulfinylacetic acid (PubChem CID 88827078) has the molecular formula C3H3NO3S
and a molecular weight of 133.13 g/mol. Its IUPAC name is 2-cyanosulfinylacetic acid.
Molecular Properties
| Compound Name | 2-cyanosulfinylacetic acid |
| PubChem CID | 88827078 |
| Molecular Formula | C3H3NO3S |
| Molecular Weight | 133.13 g/mol |
| Exact Mass | 132.98 |
| IUPAC Name | 2-cyanosulfinylacetic acid |
| SMILES | N#CS(=O)CC(=O)O |
| InChI | InChI=1S/C3H3NO3S/c4-2-8(7)1-3(5)6/h1H2,(H,5,6) |
| InChIKey | DCSDKZINOREJMB-UHFFFAOYSA-N |
| XLogP | -0.70 |
| TPSA | 78.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 133.13 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|
Analyze 2-cyanosulfinylacetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyanosulfinylacetic acid?
The IUPAC name of 2-cyanosulfinylacetic acid (CID 88827078) is 2-cyanosulfinylacetic acid.
What is the SMILES notation for 2-cyanosulfinylacetic acid?
The canonical SMILES for 2-cyanosulfinylacetic acid is N#CS(=O)CC(=O)O.
What is the InChIKey of 2-cyanosulfinylacetic acid?
The InChIKey is DCSDKZINOREJMB-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H3NO3S/c4-2-8(7)1-3(5)6/h1H2,(H,5,6).
What are the key properties of 2-cyanosulfinylacetic acid?
2-cyanosulfinylacetic acid has a molecular weight of 133.13 g/mol, XLogP of -0.70, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyanosulfinylacetic acid is sourced from PubChem (CID 88827078), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).