About bis(bis[2-(6-methylheptyl)phenyl] phosphate);nickel(2+)
bis(bis[2-(6-methylheptyl)phenyl] phosphate);nickel(2+) (PubChem CID 88827177) has the molecular formula C56H84NiO8P2
and a molecular weight of 1005.92 g/mol. Its IUPAC name is bis(bis[2-(6-methylheptyl)phenyl] phosphate);nickel(2+).
Molecular Properties
| Compound Name | bis(bis[2-(6-methylheptyl)phenyl] phosphate);nickel(2+) |
| PubChem CID | 88827177 |
| Molecular Formula | C56H84NiO8P2 |
| Molecular Weight | 1005.92 g/mol |
| Exact Mass | 1004.50 |
| IUPAC Name | bis(bis[2-(6-methylheptyl)phenyl] phosphate);nickel(2+) |
| SMILES | CC(C)CCCCCc1ccccc1OP(=O)([O-])Oc1ccccc1CCCCCC(C)C.CC(C)CCCCCc1ccccc1OP(=O)([O-])Oc1ccccc1CCCCCC(C)C.[Ni+2] |
| InChI | InChI=1S/2C28H43O4P.Ni/c2*1-23(2)15-7-5-9-17-25-19-11-13-21-27(25)31-33(29,30)32-28-22-14-12-20-26(28)18-10-6-8-16-24(3)4;/h2*11-14,19-24H,5-10,15-18H2,1-4H3,(H,29,30);/q;;+2/p-2 |
| InChIKey | SHPARFJXIFMDHE-UHFFFAOYSA-L |
| XLogP | 16.26 |
| TPSA | 117.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 67 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 1005.92 |
| LogP ≤ 5 | 16.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze bis(bis[2-(6-methylheptyl)phenyl] phosphate);nickel(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(bis[2-(6-methylheptyl)phenyl] phosphate);nickel(2+)?
The IUPAC name of bis(bis[2-(6-methylheptyl)phenyl] phosphate);nickel(2+) (CID 88827177) is bis(bis[2-(6-methylheptyl)phenyl] phosphate);nickel(2+).
What is the SMILES notation for bis(bis[2-(6-methylheptyl)phenyl] phosphate);nickel(2+)?
The canonical SMILES for bis(bis[2-(6-methylheptyl)phenyl] phosphate);nickel(2+) is CC(C)CCCCCc1ccccc1OP(=O)([O-])Oc1ccccc1CCCCCC(C)C.CC(C)CCCCCc1ccccc1OP(=O)([O-])Oc1ccccc1CCCCCC(C)C.[Ni+2].
What is the InChIKey of bis(bis[2-(6-methylheptyl)phenyl] phosphate);nickel(2+)?
The InChIKey is SHPARFJXIFMDHE-UHFFFAOYSA-L. The full InChI is InChI=1S/2C28H43O4P.Ni/c2*1-23(2)15-7-5-9-17-25-19-11-13-21-27(25)31-33(29,30)32-28-22-14-12-20-26(28)18-10-6-8-16-24(3)4;/h2*11-14,19-24H,5-10,15-18H2,1-4H3,(H,29,30);/q;;+2/p-2.
What are the key properties of bis(bis[2-(6-methylheptyl)phenyl] phosphate);nickel(2+)?
bis(bis[2-(6-methylheptyl)phenyl] phosphate);nickel(2+) has a molecular weight of 1005.92 g/mol, XLogP of 16.26, 32 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for bis(bis[2-(6-methylheptyl)phenyl] phosphate);nickel(2+) is sourced from PubChem (CID 88827177), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).