About 3,5-dimethylpyrazol-1-ide;trioxochromium
3,5-dimethylpyrazol-1-ide;trioxochromium (PubChem CID 88827968) has the molecular formula C5H7CrN2O3-
and a molecular weight of 195.12 g/mol. Its IUPAC name is 3,5-dimethylpyrazol-1-ide;trioxochromium.
Molecular Properties
| Compound Name | 3,5-dimethylpyrazol-1-ide;trioxochromium |
| PubChem CID | 88827968 |
| Molecular Formula | C5H7CrN2O3- |
| Molecular Weight | 195.12 g/mol |
| Exact Mass | 194.99 |
| IUPAC Name | 3,5-dimethylpyrazol-1-ide;trioxochromium |
| SMILES | Cc1cc(C)[n-]n1.O=[Cr](=O)=O |
| InChI | InChI=1S/C5H7N2.Cr.3O/c1-4-3-5(2)7-6-4;;;;/h3H,1-2H3;;;;/q-1;;;; |
| InChIKey | QTWARCKFEXYNSM-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 78.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.12 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3,5-dimethylpyrazol-1-ide;trioxochromium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-dimethylpyrazol-1-ide;trioxochromium?
The IUPAC name of 3,5-dimethylpyrazol-1-ide;trioxochromium (CID 88827968) is 3,5-dimethylpyrazol-1-ide;trioxochromium.
What is the SMILES notation for 3,5-dimethylpyrazol-1-ide;trioxochromium?
The canonical SMILES for 3,5-dimethylpyrazol-1-ide;trioxochromium is Cc1cc(C)[n-]n1.O=[Cr](=O)=O.
What is the InChIKey of 3,5-dimethylpyrazol-1-ide;trioxochromium?
The InChIKey is QTWARCKFEXYNSM-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7N2.Cr.3O/c1-4-3-5(2)7-6-4;;;;/h3H,1-2H3;;;;/q-1;;;;.
What are the key properties of 3,5-dimethylpyrazol-1-ide;trioxochromium?
3,5-dimethylpyrazol-1-ide;trioxochromium has a molecular weight of 195.12 g/mol, XLogP of 0.30, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dimethylpyrazol-1-ide;trioxochromium is sourced from PubChem (CID 88827968), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).