C22H27N5OS — CID 8882906
N-[[4-(dimethylamino)phenyl]methyl]-2-[(4-ethyl-5-phenyl-1,2,4-triazol-3-yl)sulfanyl]-N-methylacetamide (PubChem CID 8882906) has the molecular formula C22H27N5OS and a molecular weight of 409.56 g/mol. Its IUPAC name is N-[[4-(dimethylamino)phenyl]methyl]-2-[(4-ethyl-5-phenyl-1,2,4-triazol-3-yl)sulfanyl]-N-methylacetamide.
| Compound Name | N-[[4-(dimethylamino)phenyl]methyl]-2-[(4-ethyl-5-phenyl-1,2,4-triazol-3-yl)sulfanyl]-N-methylacetamide |
|---|---|
| PubChem CID | 8882906 |
| Molecular Formula | C22H27N5OS |
| Molecular Weight | 409.56 g/mol |
| Exact Mass | 409.19 |
| IUPAC Name | N-[[4-(dimethylamino)phenyl]methyl]-2-[(4-ethyl-5-phenyl-1,2,4-triazol-3-yl)sulfanyl]-N-methylacetamide |
| SMILES | CCn1c(SCC(=O)N(C)Cc2ccc(N(C)C)cc2)nnc1-c1ccccc1 |
| InChI | InChI=1S/C22H27N5OS/c1-5-27-21(18-9-7-6-8-10-18)23-24-22(27)29-16-20(28)26(4)15-17-11-13-19(14-12-17)25(2)3/h6-14H,5,15-16H2,1-4H3 |
| InChIKey | FXOJWWPCQFBABS-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 54.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.56 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|