About 3-pentyl-3-phosphanyl-N,N-bis(prop-2-enyl)oct-1-en-2-amine
3-pentyl-3-phosphanyl-N,N-bis(prop-2-enyl)oct-1-en-2-amine (PubChem CID 88829503) has the molecular formula C19H36NP
and a molecular weight of 309.48 g/mol. Its IUPAC name is 3-pentyl-3-phosphanyl-N,N-bis(prop-2-enyl)oct-1-en-2-amine.
Molecular Properties
| Compound Name | 3-pentyl-3-phosphanyl-N,N-bis(prop-2-enyl)oct-1-en-2-amine |
| PubChem CID | 88829503 |
| Molecular Formula | C19H36NP |
| Molecular Weight | 309.48 g/mol |
| Exact Mass | 309.26 |
| IUPAC Name | 3-pentyl-3-phosphanyl-N,N-bis(prop-2-enyl)oct-1-en-2-amine |
| SMILES | C=CCN(CC=C)C(=C)C(P)(CCCCC)CCCCC |
| InChI | InChI=1S/C19H36NP/c1-6-10-12-14-19(21,15-13-11-7-2)18(5)20(16-8-3)17-9-4/h8-9H,3-7,10-17,21H2,1-2H3 |
| InChIKey | BOVFYRSJQQKTMD-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 309.48 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 3-pentyl-3-phosphanyl-N,N-bis(prop-2-enyl)oct-1-en-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-pentyl-3-phosphanyl-N,N-bis(prop-2-enyl)oct-1-en-2-amine?
The IUPAC name of 3-pentyl-3-phosphanyl-N,N-bis(prop-2-enyl)oct-1-en-2-amine (CID 88829503) is 3-pentyl-3-phosphanyl-N,N-bis(prop-2-enyl)oct-1-en-2-amine.
What is the SMILES notation for 3-pentyl-3-phosphanyl-N,N-bis(prop-2-enyl)oct-1-en-2-amine?
The canonical SMILES for 3-pentyl-3-phosphanyl-N,N-bis(prop-2-enyl)oct-1-en-2-amine is C=CCN(CC=C)C(=C)C(P)(CCCCC)CCCCC.
What is the InChIKey of 3-pentyl-3-phosphanyl-N,N-bis(prop-2-enyl)oct-1-en-2-amine?
The InChIKey is BOVFYRSJQQKTMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H36NP/c1-6-10-12-14-19(21,15-13-11-7-2)18(5)20(16-8-3)17-9-4/h8-9H,3-7,10-17,21H2,1-2H3.
What are the key properties of 3-pentyl-3-phosphanyl-N,N-bis(prop-2-enyl)oct-1-en-2-amine?
3-pentyl-3-phosphanyl-N,N-bis(prop-2-enyl)oct-1-en-2-amine has a molecular weight of 309.48 g/mol, XLogP of 5.95, 14 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-pentyl-3-phosphanyl-N,N-bis(prop-2-enyl)oct-1-en-2-amine is sourced from PubChem (CID 88829503), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).