C5H10ClNaO2PS2 — CID 88829598
CID 88829598 (PubChem CID 88829598) has the molecular formula C5H10ClNaO2PS2 and a molecular weight of 255.68 g/mol.
| Compound Name | CID 88829598 |
|---|---|
| PubChem CID | 88829598 |
| Molecular Formula | C5H10ClNaO2PS2 |
| Molecular Weight | 255.68 g/mol |
| Exact Mass | 254.94 |
| IUPAC Name | — |
| SMILES | C=C(Cl)CSP(O)(=S)OCC.[Na] |
| InChI | InChI=1S/C5H10ClO2PS2.Na/c1-3-8-9(7,10)11-4-5(2)6;/h2-4H2,1H3,(H,7,10); |
| InChIKey | CGDFTRZQBXJGCF-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.68 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|