About N-(2-ethoxyethyl)-1-methoxy-N,N'-dimethylpropane-1,3-diamine
N-(2-ethoxyethyl)-1-methoxy-N,N'-dimethylpropane-1,3-diamine (PubChem CID 88829947) has the molecular formula C10H24N2O2
and a molecular weight of 204.31 g/mol. Its IUPAC name is N-(2-ethoxyethyl)-1-methoxy-N,N'-dimethylpropane-1,3-diamine.
Molecular Properties
| Compound Name | N-(2-ethoxyethyl)-1-methoxy-N,N'-dimethylpropane-1,3-diamine |
| PubChem CID | 88829947 |
| Molecular Formula | C10H24N2O2 |
| Molecular Weight | 204.31 g/mol |
| Exact Mass | 204.18 |
| IUPAC Name | N-(2-ethoxyethyl)-1-methoxy-N,N'-dimethylpropane-1,3-diamine |
| SMILES | CCOCCN(C)C(CCNC)OC |
| InChI | InChI=1S/C10H24N2O2/c1-5-14-9-8-12(3)10(13-4)6-7-11-2/h10-11H,5-9H2,1-4H3 |
| InChIKey | JMTIIVFCGWMPLP-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.31 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze N-(2-ethoxyethyl)-1-methoxy-N,N'-dimethylpropane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-ethoxyethyl)-1-methoxy-N,N'-dimethylpropane-1,3-diamine?
The IUPAC name of N-(2-ethoxyethyl)-1-methoxy-N,N'-dimethylpropane-1,3-diamine (CID 88829947) is N-(2-ethoxyethyl)-1-methoxy-N,N'-dimethylpropane-1,3-diamine.
What is the SMILES notation for N-(2-ethoxyethyl)-1-methoxy-N,N'-dimethylpropane-1,3-diamine?
The canonical SMILES for N-(2-ethoxyethyl)-1-methoxy-N,N'-dimethylpropane-1,3-diamine is CCOCCN(C)C(CCNC)OC.
What is the InChIKey of N-(2-ethoxyethyl)-1-methoxy-N,N'-dimethylpropane-1,3-diamine?
The InChIKey is JMTIIVFCGWMPLP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H24N2O2/c1-5-14-9-8-12(3)10(13-4)6-7-11-2/h10-11H,5-9H2,1-4H3.
What are the key properties of N-(2-ethoxyethyl)-1-methoxy-N,N'-dimethylpropane-1,3-diamine?
N-(2-ethoxyethyl)-1-methoxy-N,N'-dimethylpropane-1,3-diamine has a molecular weight of 204.31 g/mol, XLogP of 0.54, 9 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-ethoxyethyl)-1-methoxy-N,N'-dimethylpropane-1,3-diamine is sourced from PubChem (CID 88829947), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).