C20H24N4O3 — CID 88830023
ethyl (E,1E)-4-(dimethylamino)-3-(4-nitrophenyl)-2-phenylbut-3-enehydrazonate (PubChem CID 88830023) has the molecular formula C20H24N4O3 and a molecular weight of 368.44 g/mol. Its IUPAC name is ethyl (E,1E)-4-(dimethylamino)-3-(4-nitrophenyl)-2-phenylbut-3-enehydrazonate.
| Compound Name | ethyl (E,1E)-4-(dimethylamino)-3-(4-nitrophenyl)-2-phenylbut-3-enehydrazonate |
|---|---|
| PubChem CID | 88830023 |
| Molecular Formula | C20H24N4O3 |
| Molecular Weight | 368.44 g/mol |
| Exact Mass | 368.18 |
| IUPAC Name | ethyl (E,1E)-4-(dimethylamino)-3-(4-nitrophenyl)-2-phenylbut-3-enehydrazonate |
| SMILES | CCO/C(=N/N)C(/C(=C\N(C)C)c1ccc([N+](=O)[O-])cc1)c1ccccc1 |
| InChI | InChI=1S/C20H24N4O3/c1-4-27-20(22-21)19(16-8-6-5-7-9-16)18(14-23(2)3)15-10-12-17(13-11-15)24(25)26/h5-14,19H,4,21H2,1-3H3/b18-14-,22-20+ |
| InChIKey | LLWPZPHQPOLCME-VWTGEQJNSA-N |
| XLogP | 3.59 |
| TPSA | 93.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.44 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|