C9H7N3O — CID 88830408
[2-(1H-1,2,4-triazol-5-yl)cyclohexa-2,4-dien-1-ylidene]methanone (PubChem CID 88830408) has the molecular formula C9H7N3O and a molecular weight of 173.18 g/mol. Its IUPAC name is [2-(1H-1,2,4-triazol-5-yl)cyclohexa-2,4-dien-1-ylidene]methanone.
| Compound Name | [2-(1H-1,2,4-triazol-5-yl)cyclohexa-2,4-dien-1-ylidene]methanone |
|---|---|
| PubChem CID | 88830408 |
| Molecular Formula | C9H7N3O |
| Molecular Weight | 173.18 g/mol |
| Exact Mass | 173.06 |
| IUPAC Name | [2-(1H-1,2,4-triazol-5-yl)cyclohexa-2,4-dien-1-ylidene]methanone |
| SMILES | O=C=C1CC=CC=C1c1ncn[nH]1 |
| InChI | InChI=1S/C9H7N3O/c13-5-7-3-1-2-4-8(7)9-10-6-11-12-9/h1-2,4,6H,3H2,(H,10,11,12) |
| InChIKey | ZWBPAUAWDONTRM-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.18 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ketene', 'substructure': 'N/A'} |
|---|