C18H21N — CID 88831010
hexacyclo[12.2.1.02,13.03,6.05,10.07,12]heptadec-3(6)-ene-15-carbonitrile (PubChem CID 88831010) has the molecular formula C18H21N and a molecular weight of 251.37 g/mol. Its IUPAC name is hexacyclo[12.2.1.02,13.03,6.05,10.07,12]heptadec-3(6)-ene-15-carbonitrile.
| Compound Name | hexacyclo[12.2.1.02,13.03,6.05,10.07,12]heptadec-3(6)-ene-15-carbonitrile |
|---|---|
| PubChem CID | 88831010 |
| Molecular Formula | C18H21N |
| Molecular Weight | 251.37 g/mol |
| Exact Mass | 251.17 |
| IUPAC Name | hexacyclo[12.2.1.02,13.03,6.05,10.07,12]heptadec-3(6)-ene-15-carbonitrile |
| SMILES | N#CC1CC2CC1C1C3CC4CCC3C3=C(CC34)C21 |
| InChI | InChI=1S/C18H21N/c19-7-10-3-9-5-12(10)18-14-4-8-1-2-11(14)17-13(8)6-15(17)16(9)18/h8-14,16,18H,1-6H2 |
| InChIKey | DGXDOCRHUKVSMN-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.37 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|