C14H19N3O2S — CID 88831019
O-[N'-(4-acetylphenyl)-N,N-dimethylcarbamimidoyl] N,N-dimethylcarbamothioate (PubChem CID 88831019) has the molecular formula C14H19N3O2S and a molecular weight of 293.39 g/mol. Its IUPAC name is O-[N'-(4-acetylphenyl)-N,N-dimethylcarbamimidoyl] N,N-dimethylcarbamothioate.
| Compound Name | O-[N'-(4-acetylphenyl)-N,N-dimethylcarbamimidoyl] N,N-dimethylcarbamothioate |
|---|---|
| PubChem CID | 88831019 |
| Molecular Formula | C14H19N3O2S |
| Molecular Weight | 293.39 g/mol |
| Exact Mass | 293.12 |
| IUPAC Name | O-[N'-(4-acetylphenyl)-N,N-dimethylcarbamimidoyl] N,N-dimethylcarbamothioate |
| SMILES | CC(=O)c1ccc(/N=C(/OC(=S)N(C)C)N(C)C)cc1 |
| InChI | InChI=1S/C14H19N3O2S/c1-10(18)11-6-8-12(9-7-11)15-13(16(2)3)19-14(20)17(4)5/h6-9H,1-5H3/b15-13+ |
| InChIKey | PRHXDJMRNOYEED-FYWRMAATSA-N |
| XLogP | 2.30 |
| TPSA | 45.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.39 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|