C21H26ClFO5 — CID 88831567
(8S,10S,11S,13S,14S,16R,17S)-17-(2-chloroacetyl)-9-fluoro-11,16,17-trihydroxy-10,13-dimethyl-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-3-one (PubChem CID 88831567) has the molecular formula C21H26ClFO5 and a molecular weight of 412.89 g/mol. Its IUPAC name is (8S,10S,11S,13S,14S,16R,17S)-17-(2-chloroacetyl)-9-fluoro-11,16,17-trihydroxy-10,13-dimethyl-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (8S,10S,11S,13S,14S,16R,17S)-17-(2-chloroacetyl)-9-fluoro-11,16,17-trihydroxy-10,13-dimethyl-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 88831567 |
| Molecular Formula | C21H26ClFO5 |
| Molecular Weight | 412.89 g/mol |
| Exact Mass | 412.15 |
| IUPAC Name | (8S,10S,11S,13S,14S,16R,17S)-17-(2-chloroacetyl)-9-fluoro-11,16,17-trihydroxy-10,13-dimethyl-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-3-one |
| SMILES | C[C@]12C=CC(=O)C=C1CC[C@H]1[C@@H]3C[C@@H](O)[C@](O)(C(=O)CCl)[C@@]3(C)C[C@H](O)C12F |
| InChI | InChI=1S/C21H26ClFO5/c1-18-6-5-12(24)7-11(18)3-4-13-14-8-15(25)21(28,17(27)10-22)19(14,2)9-16(26)20(13,18)23/h5-7,13-16,25-26,28H,3-4,8-10H2,1-2H3/t13-,14-,15+,16-,18-,19-,20?,21-/m0/s1 |
| InChIKey | OCFIADODGPJJDE-NHMBKVLLSA-N |
| XLogP | 1.87 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.89 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|