About (4-methylphenyl)methyl N-[hydroxy(sulfanyl)phosphinothioyl]ethanimidothioate
(4-methylphenyl)methyl N-[hydroxy(sulfanyl)phosphinothioyl]ethanimidothioate (PubChem CID 88832078) has the molecular formula C10H14NOPS3
and a molecular weight of 291.40 g/mol. Its IUPAC name is (4-methylphenyl)methyl N-[hydroxy(sulfanyl)phosphinothioyl]ethanimidothioate.
Molecular Properties
| Compound Name | (4-methylphenyl)methyl N-[hydroxy(sulfanyl)phosphinothioyl]ethanimidothioate |
| PubChem CID | 88832078 |
| Molecular Formula | C10H14NOPS3 |
| Molecular Weight | 291.40 g/mol |
| Exact Mass | 291.00 |
| IUPAC Name | (4-methylphenyl)methyl N-[hydroxy(sulfanyl)phosphinothioyl]ethanimidothioate |
| SMILES | CC(=NP(O)(=S)S)SCc1ccc(C)cc1 |
| InChI | InChI=1S/C10H14NOPS3/c1-8-3-5-10(6-4-8)7-16-9(2)11-13(12,14)15/h3-6H,7H2,1-2H3,(H2,12,14,15) |
| InChIKey | URSSCTPHNZZPRZ-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.40 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze (4-methylphenyl)methyl N-[hydroxy(sulfanyl)phosphinothioyl]ethanimidothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-methylphenyl)methyl N-[hydroxy(sulfanyl)phosphinothioyl]ethanimidothioate?
The IUPAC name of (4-methylphenyl)methyl N-[hydroxy(sulfanyl)phosphinothioyl]ethanimidothioate (CID 88832078) is (4-methylphenyl)methyl N-[hydroxy(sulfanyl)phosphinothioyl]ethanimidothioate.
What is the SMILES notation for (4-methylphenyl)methyl N-[hydroxy(sulfanyl)phosphinothioyl]ethanimidothioate?
The canonical SMILES for (4-methylphenyl)methyl N-[hydroxy(sulfanyl)phosphinothioyl]ethanimidothioate is CC(=NP(O)(=S)S)SCc1ccc(C)cc1.
What is the InChIKey of (4-methylphenyl)methyl N-[hydroxy(sulfanyl)phosphinothioyl]ethanimidothioate?
The InChIKey is URSSCTPHNZZPRZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14NOPS3/c1-8-3-5-10(6-4-8)7-16-9(2)11-13(12,14)15/h3-6H,7H2,1-2H3,(H2,12,14,15).
What are the key properties of (4-methylphenyl)methyl N-[hydroxy(sulfanyl)phosphinothioyl]ethanimidothioate?
(4-methylphenyl)methyl N-[hydroxy(sulfanyl)phosphinothioyl]ethanimidothioate has a molecular weight of 291.40 g/mol, XLogP of 3.79, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4-methylphenyl)methyl N-[hydroxy(sulfanyl)phosphinothioyl]ethanimidothioate is sourced from PubChem (CID 88832078), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).