C19H16N4O4 — CID 88832111
5-methyl-3,4-dinitro-1-N,1-N-diphenylbenzene-1,2-diamine (PubChem CID 88832111) has the molecular formula C19H16N4O4 and a molecular weight of 364.36 g/mol. Its IUPAC name is 5-methyl-3,4-dinitro-1-N,1-N-diphenylbenzene-1,2-diamine.
| Compound Name | 5-methyl-3,4-dinitro-1-N,1-N-diphenylbenzene-1,2-diamine |
|---|---|
| PubChem CID | 88832111 |
| Molecular Formula | C19H16N4O4 |
| Molecular Weight | 364.36 g/mol |
| Exact Mass | 364.12 |
| IUPAC Name | 5-methyl-3,4-dinitro-1-N,1-N-diphenylbenzene-1,2-diamine |
| SMILES | Cc1cc(N(c2ccccc2)c2ccccc2)c(N)c([N+](=O)[O-])c1[N+](=O)[O-] |
| InChI | InChI=1S/C19H16N4O4/c1-13-12-16(17(20)19(23(26)27)18(13)22(24)25)21(14-8-4-2-5-9-14)15-10-6-3-7-11-15/h2-12H,20H2,1H3 |
| InChIKey | JJCANQNIMGYJMB-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 115.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.36 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|