About [6-(oxomethylidene)cyclohexa-2,4-dien-1-yl]thiourea
[6-(oxomethylidene)cyclohexa-2,4-dien-1-yl]thiourea (PubChem CID 88832428) has the molecular formula C8H8N2OS
and a molecular weight of 180.23 g/mol. Its IUPAC name is [6-(oxomethylidene)cyclohexa-2,4-dien-1-yl]thiourea.
Molecular Properties
| Compound Name | [6-(oxomethylidene)cyclohexa-2,4-dien-1-yl]thiourea |
| PubChem CID | 88832428 |
| Molecular Formula | C8H8N2OS |
| Molecular Weight | 180.23 g/mol |
| Exact Mass | 180.04 |
| IUPAC Name | [6-(oxomethylidene)cyclohexa-2,4-dien-1-yl]thiourea |
| SMILES | NC(=S)NC1C=CC=CC1=C=O |
| InChI | InChI=1S/C8H8N2OS/c9-8(12)10-7-4-2-1-3-6(7)5-11/h1-4,7H,(H3,9,10,12) |
| InChIKey | JJYIYCZPVZDFCW-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.23 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ketene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze [6-(oxomethylidene)cyclohexa-2,4-dien-1-yl]thiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [6-(oxomethylidene)cyclohexa-2,4-dien-1-yl]thiourea?
The IUPAC name of [6-(oxomethylidene)cyclohexa-2,4-dien-1-yl]thiourea (CID 88832428) is [6-(oxomethylidene)cyclohexa-2,4-dien-1-yl]thiourea.
What is the SMILES notation for [6-(oxomethylidene)cyclohexa-2,4-dien-1-yl]thiourea?
The canonical SMILES for [6-(oxomethylidene)cyclohexa-2,4-dien-1-yl]thiourea is NC(=S)NC1C=CC=CC1=C=O.
What is the InChIKey of [6-(oxomethylidene)cyclohexa-2,4-dien-1-yl]thiourea?
The InChIKey is JJYIYCZPVZDFCW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N2OS/c9-8(12)10-7-4-2-1-3-6(7)5-11/h1-4,7H,(H3,9,10,12).
What are the key properties of [6-(oxomethylidene)cyclohexa-2,4-dien-1-yl]thiourea?
[6-(oxomethylidene)cyclohexa-2,4-dien-1-yl]thiourea has a molecular weight of 180.23 g/mol, XLogP of 0.07, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [6-(oxomethylidene)cyclohexa-2,4-dien-1-yl]thiourea is sourced from PubChem (CID 88832428), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).