C20H25N2O2S+ — CID 88832445
hydroxy-[2-(6-phenylpyrrolo[2,1-b][1,3]thiazol-3-yl)acetyl]-dipropylazanium (PubChem CID 88832445) has the molecular formula C20H25N2O2S+ and a molecular weight of 357.50 g/mol. Its IUPAC name is hydroxy-[2-(6-phenylpyrrolo[2,1-b][1,3]thiazol-3-yl)acetyl]-dipropylazanium.
| Compound Name | hydroxy-[2-(6-phenylpyrrolo[2,1-b][1,3]thiazol-3-yl)acetyl]-dipropylazanium |
|---|---|
| PubChem CID | 88832445 |
| Molecular Formula | C20H25N2O2S+ |
| Molecular Weight | 357.50 g/mol |
| Exact Mass | 357.16 |
| IUPAC Name | hydroxy-[2-(6-phenylpyrrolo[2,1-b][1,3]thiazol-3-yl)acetyl]-dipropylazanium |
| SMILES | CCC[N+](O)(CCC)C(=O)Cc1csc2cc(-c3ccccc3)cn12 |
| InChI | InChI=1S/C20H25N2O2S/c1-3-10-22(24,11-4-2)20(23)13-18-15-25-19-12-17(14-21(18)19)16-8-6-5-7-9-16/h5-9,12,14-15,24H,3-4,10-11,13H2,1-2H3/q+1 |
| InChIKey | XMYIJVHBJJGONZ-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 41.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.50 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|