C9H19N2O2P — CID 88832521
1,3-diethyl-2-[(2S,3R)-3-methyloxiran-2-yl]-1,3,2λ5-diazaphospholidine 2-oxide (PubChem CID 88832521) has the molecular formula C9H19N2O2P and a molecular weight of 218.24 g/mol. Its IUPAC name is 1,3-diethyl-2-[(2S,3R)-3-methyloxiran-2-yl]-1,3,2λ5-diazaphospholidine 2-oxide.
| Compound Name | 1,3-diethyl-2-[(2S,3R)-3-methyloxiran-2-yl]-1,3,2λ5-diazaphospholidine 2-oxide |
|---|---|
| PubChem CID | 88832521 |
| Molecular Formula | C9H19N2O2P |
| Molecular Weight | 218.24 g/mol |
| Exact Mass | 218.12 |
| IUPAC Name | 1,3-diethyl-2-[(2S,3R)-3-methyloxiran-2-yl]-1,3,2λ5-diazaphospholidine 2-oxide |
| SMILES | CCN1CCN(CC)P1(=O)[C@@H]1O[C@@H]1C |
| InChI | InChI=1S/C9H19N2O2P/c1-4-10-6-7-11(5-2)14(10,12)9-8(3)13-9/h8-9H,4-7H2,1-3H3/t8-,9+/m1/s1 |
| InChIKey | MWJUJWGGCGSEMY-BDAKNGLRSA-N |
| XLogP | 1.58 |
| TPSA | 36.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.24 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|