About bis[3-bromo-2,2-bis(bromomethyl)propyl] 1-hydroxyprop-2-enyl phosphate
bis[3-bromo-2,2-bis(bromomethyl)propyl] 1-hydroxyprop-2-enyl phosphate (PubChem CID 88832949) has the molecular formula C13H21Br6O5P
and a molecular weight of 767.70 g/mol. Its IUPAC name is bis[3-bromo-2,2-bis(bromomethyl)propyl] 1-hydroxyprop-2-enyl phosphate.
Molecular Properties
| Compound Name | bis[3-bromo-2,2-bis(bromomethyl)propyl] 1-hydroxyprop-2-enyl phosphate |
| PubChem CID | 88832949 |
| Molecular Formula | C13H21Br6O5P |
| Molecular Weight | 767.70 g/mol |
| Exact Mass | 761.62 |
| IUPAC Name | bis[3-bromo-2,2-bis(bromomethyl)propyl] 1-hydroxyprop-2-enyl phosphate |
| SMILES | C=CC(O)OP(=O)(OCC(CBr)(CBr)CBr)OCC(CBr)(CBr)CBr |
| InChI | InChI=1S/C13H21Br6O5P/c1-2-11(20)24-25(21,22-9-12(3-14,4-15)5-16)23-10-13(6-17,7-18)8-19/h2,11,20H,1,3-10H2 |
| InChIKey | LBSGIBDAEZRWOS-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 767.70 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze bis[3-bromo-2,2-bis(bromomethyl)propyl] 1-hydroxyprop-2-enyl phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis[3-bromo-2,2-bis(bromomethyl)propyl] 1-hydroxyprop-2-enyl phosphate?
The IUPAC name of bis[3-bromo-2,2-bis(bromomethyl)propyl] 1-hydroxyprop-2-enyl phosphate (CID 88832949) is bis[3-bromo-2,2-bis(bromomethyl)propyl] 1-hydroxyprop-2-enyl phosphate.
What is the SMILES notation for bis[3-bromo-2,2-bis(bromomethyl)propyl] 1-hydroxyprop-2-enyl phosphate?
The canonical SMILES for bis[3-bromo-2,2-bis(bromomethyl)propyl] 1-hydroxyprop-2-enyl phosphate is C=CC(O)OP(=O)(OCC(CBr)(CBr)CBr)OCC(CBr)(CBr)CBr.
What is the InChIKey of bis[3-bromo-2,2-bis(bromomethyl)propyl] 1-hydroxyprop-2-enyl phosphate?
The InChIKey is LBSGIBDAEZRWOS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21Br6O5P/c1-2-11(20)24-25(21,22-9-12(3-14,4-15)5-16)23-10-13(6-17,7-18)8-19/h2,11,20H,1,3-10H2.
What are the key properties of bis[3-bromo-2,2-bis(bromomethyl)propyl] 1-hydroxyprop-2-enyl phosphate?
bis[3-bromo-2,2-bis(bromomethyl)propyl] 1-hydroxyprop-2-enyl phosphate has a molecular weight of 767.70 g/mol, XLogP of 5.99, 15 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for bis[3-bromo-2,2-bis(bromomethyl)propyl] 1-hydroxyprop-2-enyl phosphate is sourced from PubChem (CID 88832949), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).