(2-aminoethylamino) 2,2-bis(4-hydroxyphenyl)acetate

C16H18N2O4 — CID 88833049

IUPAC(2-aminoethylamino) 2,2-bis(4-hydroxyphenyl)acetate
SMILESNCCNOC(=O)C(c1ccc(O)cc1)c1ccc(O)cc1
InChIInChI=1S/C16H18N2O4/c17-9-10-18-22-16(21)15(11-1-5-13(19)6-2-11)12-3-7-14(20)8-4-12/h1-8,15,18-20H,9-10,17H2
InChIKeyRXGDRZKFWZTZNP-UHFFFAOYSA-N
MW302.33 g/mol
LogP1.24
Rot. Bonds6

About (2-aminoethylamino) 2,2-bis(4-hydroxyphenyl)acetate

(2-aminoethylamino) 2,2-bis(4-hydroxyphenyl)acetate (PubChem CID 88833049) has the molecular formula C16H18N2O4 and a molecular weight of 302.33 g/mol. Its IUPAC name is (2-aminoethylamino) 2,2-bis(4-hydroxyphenyl)acetate.

Molecular Properties

Compound Name(2-aminoethylamino) 2,2-bis(4-hydroxyphenyl)acetate
PubChem CID88833049
Molecular FormulaC16H18N2O4
Molecular Weight302.33 g/mol
Exact Mass302.13
IUPAC Name(2-aminoethylamino) 2,2-bis(4-hydroxyphenyl)acetate
SMILESNCCNOC(=O)C(c1ccc(O)cc1)c1ccc(O)cc1
InChIInChI=1S/C16H18N2O4/c17-9-10-18-22-16(21)15(11-1-5-13(19)6-2-11)12-3-7-14(20)8-4-12/h1-8,15,18-20H,9-10,17H2
InChIKeyRXGDRZKFWZTZNP-UHFFFAOYSA-N
XLogP1.24
TPSA104.81 Ų
H-Bond Donors4
H-Bond Acceptors6
Rotatable Bonds6
Heavy Atoms22
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500302.33
LogP ≤ 51.24
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 106

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze (2-aminoethylamino) 2,2-bis(4-hydroxyphenyl)acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2-aminoethylamino) 2,2-bis(4-hydroxyphenyl)acetate?
The IUPAC name of (2-aminoethylamino) 2,2-bis(4-hydroxyphenyl)acetate (CID 88833049) is (2-aminoethylamino) 2,2-bis(4-hydroxyphenyl)acetate.
What is the SMILES notation for (2-aminoethylamino) 2,2-bis(4-hydroxyphenyl)acetate?
The canonical SMILES for (2-aminoethylamino) 2,2-bis(4-hydroxyphenyl)acetate is NCCNOC(=O)C(c1ccc(O)cc1)c1ccc(O)cc1.
What is the InChIKey of (2-aminoethylamino) 2,2-bis(4-hydroxyphenyl)acetate?
The InChIKey is RXGDRZKFWZTZNP-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18N2O4/c17-9-10-18-22-16(21)15(11-1-5-13(19)6-2-11)12-3-7-14(20)8-4-12/h1-8,15,18-20H,9-10,17H2.
What are the key properties of (2-aminoethylamino) 2,2-bis(4-hydroxyphenyl)acetate?
(2-aminoethylamino) 2,2-bis(4-hydroxyphenyl)acetate has a molecular weight of 302.33 g/mol, XLogP of 1.24, 6 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2-aminoethylamino) 2,2-bis(4-hydroxyphenyl)acetate is sourced from PubChem (CID 88833049), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).