C21H35ClN2 — CID 88833226
1-benzyl-3-butyl-2-heptyl-4,5-dihydroimidazol-1-ium chloride (PubChem CID 88833226) has the molecular formula C21H35ClN2 and a molecular weight of 350.98 g/mol. Its IUPAC name is 1-benzyl-3-butyl-2-heptyl-4,5-dihydroimidazol-1-ium chloride.
| Compound Name | 1-benzyl-3-butyl-2-heptyl-4,5-dihydroimidazol-1-ium chloride |
|---|---|
| PubChem CID | 88833226 |
| Molecular Formula | C21H35ClN2 |
| Molecular Weight | 350.98 g/mol |
| Exact Mass | 350.25 |
| IUPAC Name | 1-benzyl-3-butyl-2-heptyl-4,5-dihydroimidazol-1-ium chloride |
| SMILES | CCCCCCCC1=[N+](Cc2ccccc2)CCN1CCCC.[Cl-] |
| InChI | InChI=1S/C21H35N2.ClH/c1-3-5-7-8-12-15-21-22(16-6-4-2)17-18-23(21)19-20-13-10-9-11-14-20;/h9-11,13-14H,3-8,12,15-19H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | DMWNLRJKBLLLFB-UHFFFAOYSA-M |
| XLogP | 2.08 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.98 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|