C25H34O3S — CID 88833494
(2E,4E,6E,8E)-3,7-dimethyl-1-[(2E)-penta-2,4-dienyl]sulfonyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraen-1-one (PubChem CID 88833494) has the molecular formula C25H34O3S and a molecular weight of 414.61 g/mol. Its IUPAC name is (2E,4E,6E,8E)-3,7-dimethyl-1-[(2E)-penta-2,4-dienyl]sulfonyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraen-1-one.
| Compound Name | (2E,4E,6E,8E)-3,7-dimethyl-1-[(2E)-penta-2,4-dienyl]sulfonyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraen-1-one |
|---|---|
| PubChem CID | 88833494 |
| Molecular Formula | C25H34O3S |
| Molecular Weight | 414.61 g/mol |
| Exact Mass | 414.22 |
| IUPAC Name | (2E,4E,6E,8E)-3,7-dimethyl-1-[(2E)-penta-2,4-dienyl]sulfonyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraen-1-one |
| SMILES | C=C/C=C/CS(=O)(=O)C(=O)/C=C(C)/C=C/C=C(C)/C=C/C1=C(C)CCCC1(C)C |
| InChI | InChI=1S/C25H34O3S/c1-7-8-9-18-29(27,28)24(26)19-21(3)13-10-12-20(2)15-16-23-22(4)14-11-17-25(23,5)6/h7-10,12-13,15-16,19H,1,11,14,17-18H2,2-6H3/b9-8+,13-10+,16-15+,20-12+,21-19+ |
| InChIKey | YTPSRKPVKUWQOS-FGGDHWPOSA-N |
| XLogP | 6.20 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.61 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|