hydrazine;methyl hydrogen sulfite

CH8N2O3S — CID 88833602

IUPAChydrazine;methyl hydrogen sulfite
SMILESCOS(=O)O.NN
InChIInChI=1S/CH4O3S.H4N2/c1-4-5(2)3;1-2/h1H3,(H,2,3);1-2H2
InChIKeyYKGVHTOEGMFLMV-UHFFFAOYSA-N
MW128.15 g/mol
LogP-1.41
Rot. Bonds1

About hydrazine;methyl hydrogen sulfite

hydrazine;methyl hydrogen sulfite (PubChem CID 88833602) has the molecular formula CH8N2O3S and a molecular weight of 128.15 g/mol. Its IUPAC name is hydrazine;methyl hydrogen sulfite.

Molecular Properties

Compound Namehydrazine;methyl hydrogen sulfite
PubChem CID88833602
Molecular FormulaCH8N2O3S
Molecular Weight128.15 g/mol
Exact Mass128.03
IUPAC Namehydrazine;methyl hydrogen sulfite
SMILESCOS(=O)O.NN
InChIInChI=1S/CH4O3S.H4N2/c1-4-5(2)3;1-2/h1H3,(H,2,3);1-2H2
InChIKeyYKGVHTOEGMFLMV-UHFFFAOYSA-N
XLogP-1.41
TPSA98.57 Ų
H-Bond Donors3
H-Bond Acceptors4
Rotatable Bonds1
Heavy Atoms7
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500128.15
LogP ≤ 5-1.41
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'}

Analyze hydrazine;methyl hydrogen sulfite with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of hydrazine;methyl hydrogen sulfite?
The IUPAC name of hydrazine;methyl hydrogen sulfite (CID 88833602) is hydrazine;methyl hydrogen sulfite.
What is the SMILES notation for hydrazine;methyl hydrogen sulfite?
The canonical SMILES for hydrazine;methyl hydrogen sulfite is COS(=O)O.NN.
What is the InChIKey of hydrazine;methyl hydrogen sulfite?
The InChIKey is YKGVHTOEGMFLMV-UHFFFAOYSA-N. The full InChI is InChI=1S/CH4O3S.H4N2/c1-4-5(2)3;1-2/h1H3,(H,2,3);1-2H2.
What are the key properties of hydrazine;methyl hydrogen sulfite?
hydrazine;methyl hydrogen sulfite has a molecular weight of 128.15 g/mol, XLogP of -1.41, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for hydrazine;methyl hydrogen sulfite is sourced from PubChem (CID 88833602), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).