About hydrazine;methyl hydrogen sulfite
hydrazine;methyl hydrogen sulfite (PubChem CID 88833602) has the molecular formula CH8N2O3S
and a molecular weight of 128.15 g/mol. Its IUPAC name is hydrazine;methyl hydrogen sulfite.
Molecular Properties
| Compound Name | hydrazine;methyl hydrogen sulfite |
| PubChem CID | 88833602 |
| Molecular Formula | CH8N2O3S |
| Molecular Weight | 128.15 g/mol |
| Exact Mass | 128.03 |
| IUPAC Name | hydrazine;methyl hydrogen sulfite |
| SMILES | COS(=O)O.NN |
| InChI | InChI=1S/CH4O3S.H4N2/c1-4-5(2)3;1-2/h1H3,(H,2,3);1-2H2 |
| InChIKey | YKGVHTOEGMFLMV-UHFFFAOYSA-N |
| XLogP | -1.41 |
| TPSA | 98.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 128.15 |
| LogP ≤ 5 | -1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze hydrazine;methyl hydrogen sulfite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydrazine;methyl hydrogen sulfite?
The IUPAC name of hydrazine;methyl hydrogen sulfite (CID 88833602) is hydrazine;methyl hydrogen sulfite.
What is the SMILES notation for hydrazine;methyl hydrogen sulfite?
The canonical SMILES for hydrazine;methyl hydrogen sulfite is COS(=O)O.NN.
What is the InChIKey of hydrazine;methyl hydrogen sulfite?
The InChIKey is YKGVHTOEGMFLMV-UHFFFAOYSA-N. The full InChI is InChI=1S/CH4O3S.H4N2/c1-4-5(2)3;1-2/h1H3,(H,2,3);1-2H2.
What are the key properties of hydrazine;methyl hydrogen sulfite?
hydrazine;methyl hydrogen sulfite has a molecular weight of 128.15 g/mol, XLogP of -1.41, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for hydrazine;methyl hydrogen sulfite is sourced from PubChem (CID 88833602), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).