C16H13Cl2NO — CID 88833708
3,3-dichloro-11-azatetracyclo[10.4.0.02,4.05,10]hexadeca-1(16),7,9,12,14-pentaene-11-carbaldehyde (PubChem CID 88833708) has the molecular formula C16H13Cl2NO and a molecular weight of 306.19 g/mol. Its IUPAC name is 3,3-dichloro-11-azatetracyclo[10.4.0.02,4.05,10]hexadeca-1(16),7,9,12,14-pentaene-11-carbaldehyde.
| Compound Name | 3,3-dichloro-11-azatetracyclo[10.4.0.02,4.05,10]hexadeca-1(16),7,9,12,14-pentaene-11-carbaldehyde |
|---|---|
| PubChem CID | 88833708 |
| Molecular Formula | C16H13Cl2NO |
| Molecular Weight | 306.19 g/mol |
| Exact Mass | 305.04 |
| IUPAC Name | 3,3-dichloro-11-azatetracyclo[10.4.0.02,4.05,10]hexadeca-1(16),7,9,12,14-pentaene-11-carbaldehyde |
| SMILES | O=CN1C2=CC=CCC2C2C(c3ccccc31)C2(Cl)Cl |
| InChI | InChI=1S/C16H13Cl2NO/c17-16(18)14-10-5-1-3-7-12(10)19(9-20)13-8-4-2-6-11(13)15(14)16/h1-5,7-9,11,14-15H,6H2 |
| InChIKey | VHNGZTLNIYUOFG-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.19 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|