C22H36O3 — CID 88834465
3,7-dimethylocta-1,6-dien-3-yl 2-[(2E)-3,7-dimethylocta-2,6-dienoxy]acetate (PubChem CID 88834465) has the molecular formula C22H36O3 and a molecular weight of 348.53 g/mol. Its IUPAC name is 3,7-dimethylocta-1,6-dien-3-yl 2-[(2E)-3,7-dimethylocta-2,6-dienoxy]acetate.
| Compound Name | 3,7-dimethylocta-1,6-dien-3-yl 2-[(2E)-3,7-dimethylocta-2,6-dienoxy]acetate |
|---|---|
| PubChem CID | 88834465 |
| Molecular Formula | C22H36O3 |
| Molecular Weight | 348.53 g/mol |
| Exact Mass | 348.27 |
| IUPAC Name | 3,7-dimethylocta-1,6-dien-3-yl 2-[(2E)-3,7-dimethylocta-2,6-dienoxy]acetate |
| SMILES | C=CC(C)(CCC=C(C)C)OC(=O)COC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C22H36O3/c1-8-22(7,15-10-12-19(4)5)25-21(23)17-24-16-14-20(6)13-9-11-18(2)3/h8,11-12,14H,1,9-10,13,15-17H2,2-7H3/b20-14+ |
| InChIKey | XFBFHZGJCRBJJM-XSFVSMFZSA-N |
| XLogP | 5.93 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.53 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|