C10H12O4 — CID 88834539
3-(1-prop-2-enoxypropyl)furan-2,5-dione (PubChem CID 88834539) has the molecular formula C10H12O4 and a molecular weight of 196.20 g/mol. Its IUPAC name is 3-(1-prop-2-enoxypropyl)furan-2,5-dione.
| Compound Name | 3-(1-prop-2-enoxypropyl)furan-2,5-dione |
|---|---|
| PubChem CID | 88834539 |
| Molecular Formula | C10H12O4 |
| Molecular Weight | 196.20 g/mol |
| Exact Mass | 196.07 |
| IUPAC Name | 3-(1-prop-2-enoxypropyl)furan-2,5-dione |
| SMILES | C=CCOC(CC)C1=CC(=O)OC1=O |
| InChI | InChI=1S/C10H12O4/c1-3-5-13-8(4-2)7-6-9(11)14-10(7)12/h3,6,8H,1,4-5H2,2H3 |
| InChIKey | KZIHDUHNLUNDBN-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.20 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|