About 1,2-bis(5-cyclopropylpentyl)cyclohexane-1,4-dicarboxylic acid
1,2-bis(5-cyclopropylpentyl)cyclohexane-1,4-dicarboxylic acid (PubChem CID 88835065) has the molecular formula C24H40O4
and a molecular weight of 392.58 g/mol. Its IUPAC name is 1,2-bis(5-cyclopropylpentyl)cyclohexane-1,4-dicarboxylic acid.
Molecular Properties
| Compound Name | 1,2-bis(5-cyclopropylpentyl)cyclohexane-1,4-dicarboxylic acid |
| PubChem CID | 88835065 |
| Molecular Formula | C24H40O4 |
| Molecular Weight | 392.58 g/mol |
| Exact Mass | 392.29 |
| IUPAC Name | 1,2-bis(5-cyclopropylpentyl)cyclohexane-1,4-dicarboxylic acid |
| SMILES | O=C(O)C1CCC(CCCCCC2CC2)(C(=O)O)C(CCCCCC2CC2)C1 |
| InChI | InChI=1S/C24H40O4/c25-22(26)20-14-16-24(23(27)28,15-6-2-4-8-19-12-13-19)21(17-20)9-5-1-3-7-18-10-11-18/h18-21H,1-17H2,(H,25,26)(H,27,28) |
| InChIKey | SQIISJMAAZHZQC-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 392.58 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1,2-bis(5-cyclopropylpentyl)cyclohexane-1,4-dicarboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-bis(5-cyclopropylpentyl)cyclohexane-1,4-dicarboxylic acid?
The IUPAC name of 1,2-bis(5-cyclopropylpentyl)cyclohexane-1,4-dicarboxylic acid (CID 88835065) is 1,2-bis(5-cyclopropylpentyl)cyclohexane-1,4-dicarboxylic acid.
What is the SMILES notation for 1,2-bis(5-cyclopropylpentyl)cyclohexane-1,4-dicarboxylic acid?
The canonical SMILES for 1,2-bis(5-cyclopropylpentyl)cyclohexane-1,4-dicarboxylic acid is O=C(O)C1CCC(CCCCCC2CC2)(C(=O)O)C(CCCCCC2CC2)C1.
What is the InChIKey of 1,2-bis(5-cyclopropylpentyl)cyclohexane-1,4-dicarboxylic acid?
The InChIKey is SQIISJMAAZHZQC-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H40O4/c25-22(26)20-14-16-24(23(27)28,15-6-2-4-8-19-12-13-19)21(17-20)9-5-1-3-7-18-10-11-18/h18-21H,1-17H2,(H,25,26)(H,27,28).
What are the key properties of 1,2-bis(5-cyclopropylpentyl)cyclohexane-1,4-dicarboxylic acid?
1,2-bis(5-cyclopropylpentyl)cyclohexane-1,4-dicarboxylic acid has a molecular weight of 392.58 g/mol, XLogP of 6.28, 14 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-bis(5-cyclopropylpentyl)cyclohexane-1,4-dicarboxylic acid is sourced from PubChem (CID 88835065), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).