C15H32NO3P — CID 88835149
(5-amino-1,3,3-trimethylcyclohexyl)-(2,3-dimethylbutan-2-yloxy)phosphinic acid (PubChem CID 88835149) has the molecular formula C15H32NO3P and a molecular weight of 305.40 g/mol. Its IUPAC name is (5-amino-1,3,3-trimethylcyclohexyl)-(2,3-dimethylbutan-2-yloxy)phosphinic acid.
| Compound Name | (5-amino-1,3,3-trimethylcyclohexyl)-(2,3-dimethylbutan-2-yloxy)phosphinic acid |
|---|---|
| PubChem CID | 88835149 |
| Molecular Formula | C15H32NO3P |
| Molecular Weight | 305.40 g/mol |
| Exact Mass | 305.21 |
| IUPAC Name | (5-amino-1,3,3-trimethylcyclohexyl)-(2,3-dimethylbutan-2-yloxy)phosphinic acid |
| SMILES | CC(C)C(C)(C)OP(=O)(O)C1(C)CC(N)CC(C)(C)C1 |
| InChI | InChI=1S/C15H32NO3P/c1-11(2)14(5,6)19-20(17,18)15(7)9-12(16)8-13(3,4)10-15/h11-12H,8-10,16H2,1-7H3,(H,17,18) |
| InChIKey | PPJGFYIRZTUPOA-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.40 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|