C8H17ClF3N5 — CID 88835261
1-butyl-3-(diaminomethylidene)-2-(2,2,2-trifluoroethyl)guanidine;hydrochloride (PubChem CID 88835261) has the molecular formula C8H17ClF3N5 and a molecular weight of 275.71 g/mol. Its IUPAC name is 1-butyl-3-(diaminomethylidene)-2-(2,2,2-trifluoroethyl)guanidine;hydrochloride.
| Compound Name | 1-butyl-3-(diaminomethylidene)-2-(2,2,2-trifluoroethyl)guanidine;hydrochloride |
|---|---|
| PubChem CID | 88835261 |
| Molecular Formula | C8H17ClF3N5 |
| Molecular Weight | 275.71 g/mol |
| Exact Mass | 275.11 |
| IUPAC Name | 1-butyl-3-(diaminomethylidene)-2-(2,2,2-trifluoroethyl)guanidine;hydrochloride |
| SMILES | CCCCN/C(N=C(N)N)=N\CC(F)(F)F.Cl |
| InChI | InChI=1S/C8H16F3N5.ClH/c1-2-3-4-14-7(16-6(12)13)15-5-8(9,10)11;/h2-5H2,1H3,(H5,12,13,14,15,16);1H |
| InChIKey | IKGZWBAEGYJSLV-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 88.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.71 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|