C15H11Br — CID 88835357
15-bromotricyclo[9.4.0.02,7]pentadeca-1,3,5,7,9,11,13-heptaene (PubChem CID 88835357) has the molecular formula C15H11Br and a molecular weight of 271.16 g/mol. Its IUPAC name is 15-bromotricyclo[9.4.0.02,7]pentadeca-1,3,5,7,9,11,13-heptaene.
| Compound Name | 15-bromotricyclo[9.4.0.02,7]pentadeca-1,3,5,7,9,11,13-heptaene |
|---|---|
| PubChem CID | 88835357 |
| Molecular Formula | C15H11Br |
| Molecular Weight | 271.16 g/mol |
| Exact Mass | 270.00 |
| IUPAC Name | 15-bromotricyclo[9.4.0.02,7]pentadeca-1,3,5,7,9,11,13-heptaene |
| SMILES | BrC1C=CC=C2C=CC=c3ccccc3=C21 |
| InChI | InChI=1S/C15H11Br/c16-14-10-4-8-12-7-3-6-11-5-1-2-9-13(11)15(12)14/h1-10,14H |
| InChIKey | ZEAROYKCSLGPAS-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.16 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|