About (2,3-diamino-5-bromophenyl) formate
(2,3-diamino-5-bromophenyl) formate (PubChem CID 88835372) has the molecular formula C7H7BrN2O2
and a molecular weight of 231.05 g/mol. Its IUPAC name is (2,3-diamino-5-bromophenyl) formate.
Molecular Properties
| Compound Name | (2,3-diamino-5-bromophenyl) formate |
| PubChem CID | 88835372 |
| Molecular Formula | C7H7BrN2O2 |
| Molecular Weight | 231.05 g/mol |
| Exact Mass | 229.97 |
| IUPAC Name | (2,3-diamino-5-bromophenyl) formate |
| SMILES | Nc1cc(Br)cc(OC=O)c1N |
| InChI | InChI=1S/C7H7BrN2O2/c8-4-1-5(9)7(10)6(2-4)12-3-11/h1-3H,9-10H2 |
| InChIKey | PKMBIIKAOJAGPC-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 78.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.05 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze (2,3-diamino-5-bromophenyl) formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,3-diamino-5-bromophenyl) formate?
The IUPAC name of (2,3-diamino-5-bromophenyl) formate (CID 88835372) is (2,3-diamino-5-bromophenyl) formate.
What is the SMILES notation for (2,3-diamino-5-bromophenyl) formate?
The canonical SMILES for (2,3-diamino-5-bromophenyl) formate is Nc1cc(Br)cc(OC=O)c1N.
What is the InChIKey of (2,3-diamino-5-bromophenyl) formate?
The InChIKey is PKMBIIKAOJAGPC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7BrN2O2/c8-4-1-5(9)7(10)6(2-4)12-3-11/h1-3H,9-10H2.
What are the key properties of (2,3-diamino-5-bromophenyl) formate?
(2,3-diamino-5-bromophenyl) formate has a molecular weight of 231.05 g/mol, XLogP of 1.15, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2,3-diamino-5-bromophenyl) formate is sourced from PubChem (CID 88835372), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).