C7H15ClF3N5 — CID 88835805
3-(diaminomethylidene)-2-ethyl-1-methyl-1-(2,2,2-trifluoroethyl)guanidine;hydrochloride (PubChem CID 88835805) has the molecular formula C7H15ClF3N5 and a molecular weight of 261.68 g/mol. Its IUPAC name is 3-(diaminomethylidene)-2-ethyl-1-methyl-1-(2,2,2-trifluoroethyl)guanidine;hydrochloride.
| Compound Name | 3-(diaminomethylidene)-2-ethyl-1-methyl-1-(2,2,2-trifluoroethyl)guanidine;hydrochloride |
|---|---|
| PubChem CID | 88835805 |
| Molecular Formula | C7H15ClF3N5 |
| Molecular Weight | 261.68 g/mol |
| Exact Mass | 261.10 |
| IUPAC Name | 3-(diaminomethylidene)-2-ethyl-1-methyl-1-(2,2,2-trifluoroethyl)guanidine;hydrochloride |
| SMILES | CC/N=C(/N=C(N)N)N(C)CC(F)(F)F.Cl |
| InChI | InChI=1S/C7H14F3N5.ClH/c1-3-13-6(14-5(11)12)15(2)4-7(8,9)10;/h3-4H2,1-2H3,(H4,11,12,13,14);1H |
| InChIKey | BOAYPMKORCKHPS-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 80.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.68 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|