C11H12O10 — CID 88836060
4-(3-carboxy-2-prop-2-enoyloxypropanoyl)oxy-3-hydroxy-4-oxobutanoic acid (PubChem CID 88836060) has the molecular formula C11H12O10 and a molecular weight of 304.21 g/mol. Its IUPAC name is 4-(3-carboxy-2-prop-2-enoyloxypropanoyl)oxy-3-hydroxy-4-oxobutanoic acid.
| Compound Name | 4-(3-carboxy-2-prop-2-enoyloxypropanoyl)oxy-3-hydroxy-4-oxobutanoic acid |
|---|---|
| PubChem CID | 88836060 |
| Molecular Formula | C11H12O10 |
| Molecular Weight | 304.21 g/mol |
| Exact Mass | 304.04 |
| IUPAC Name | 4-(3-carboxy-2-prop-2-enoyloxypropanoyl)oxy-3-hydroxy-4-oxobutanoic acid |
| SMILES | C=CC(=O)OC(CC(=O)O)C(=O)OC(=O)C(O)CC(=O)O |
| InChI | InChI=1S/C11H12O10/c1-2-9(17)20-6(4-8(15)16)11(19)21-10(18)5(12)3-7(13)14/h2,5-6,12H,1,3-4H2,(H,13,14)(H,15,16) |
| InChIKey | VROJBGYIWZBIKU-UHFFFAOYSA-N |
| XLogP | -1.54 |
| TPSA | 164.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.21 |
| LogP ≤ 5 | -1.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|