C19H20ClN5O2S — CID 8883669
N-[2-(4-chlorophenoxy)ethyl]-2-[(4-ethyl-5-pyridin-4-yl-1,2,4-triazol-3-yl)sulfanyl]acetamide (PubChem CID 8883669) has the molecular formula C19H20ClN5O2S and a molecular weight of 417.92 g/mol. Its IUPAC name is N-[2-(4-chlorophenoxy)ethyl]-2-[(4-ethyl-5-pyridin-4-yl-1,2,4-triazol-3-yl)sulfanyl]acetamide.
| Compound Name | N-[2-(4-chlorophenoxy)ethyl]-2-[(4-ethyl-5-pyridin-4-yl-1,2,4-triazol-3-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 8883669 |
| Molecular Formula | C19H20ClN5O2S |
| Molecular Weight | 417.92 g/mol |
| Exact Mass | 417.10 |
| IUPAC Name | N-[2-(4-chlorophenoxy)ethyl]-2-[(4-ethyl-5-pyridin-4-yl-1,2,4-triazol-3-yl)sulfanyl]acetamide |
| SMILES | CCn1c(SCC(=O)NCCOc2ccc(Cl)cc2)nnc1-c1ccncc1 |
| InChI | InChI=1S/C19H20ClN5O2S/c1-2-25-18(14-7-9-21-10-8-14)23-24-19(25)28-13-17(26)22-11-12-27-16-5-3-15(20)4-6-16/h3-10H,2,11-13H2,1H3,(H,22,26) |
| InChIKey | BJCSFHLQXWGMJX-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.92 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|