C14H22O9 — CID 88836876
(2,3-dihydroxy-2-methoxyhex-5-enoyl) 2,3-dihydroxy-2-methoxyhex-5-enoate (PubChem CID 88836876) has the molecular formula C14H22O9 and a molecular weight of 334.32 g/mol. Its IUPAC name is (2,3-dihydroxy-2-methoxyhex-5-enoyl) 2,3-dihydroxy-2-methoxyhex-5-enoate.
| Compound Name | (2,3-dihydroxy-2-methoxyhex-5-enoyl) 2,3-dihydroxy-2-methoxyhex-5-enoate |
|---|---|
| PubChem CID | 88836876 |
| Molecular Formula | C14H22O9 |
| Molecular Weight | 334.32 g/mol |
| Exact Mass | 334.13 |
| IUPAC Name | (2,3-dihydroxy-2-methoxyhex-5-enoyl) 2,3-dihydroxy-2-methoxyhex-5-enoate |
| SMILES | C=CCC(O)C(O)(OC)C(=O)OC(=O)C(O)(OC)C(O)CC=C |
| InChI | InChI=1S/C14H22O9/c1-5-7-9(15)13(19,21-3)11(17)23-12(18)14(20,22-4)10(16)8-6-2/h5-6,9-10,15-16,19-20H,1-2,7-8H2,3-4H3 |
| InChIKey | JYFYLYKXPZSOGQ-UHFFFAOYSA-N |
| XLogP | -1.40 |
| TPSA | 142.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.32 |
| LogP ≤ 5 | -1.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|