About 5-(3,4-dichlorophenyl)-1H-imidazol-2-amine;3-methyl-2-nitroimidazole-4-carbaldehyde
5-(3,4-dichlorophenyl)-1H-imidazol-2-amine;3-methyl-2-nitroimidazole-4-carbaldehyde (PubChem CID 88837370) has the molecular formula C14H12Cl2N6O3
and a molecular weight of 383.20 g/mol. Its IUPAC name is 5-(3,4-dichlorophenyl)-1H-imidazol-2-amine;3-methyl-2-nitroimidazole-4-carbaldehyde.
Molecular Properties
| Compound Name | 5-(3,4-dichlorophenyl)-1H-imidazol-2-amine;3-methyl-2-nitroimidazole-4-carbaldehyde |
| PubChem CID | 88837370 |
| Molecular Formula | C14H12Cl2N6O3 |
| Molecular Weight | 383.20 g/mol |
| Exact Mass | 382.03 |
| IUPAC Name | 5-(3,4-dichlorophenyl)-1H-imidazol-2-amine;3-methyl-2-nitroimidazole-4-carbaldehyde |
| SMILES | Cn1c(C=O)cnc1[N+](=O)[O-].Nc1ncc(-c2ccc(Cl)c(Cl)c2)[nH]1 |
| InChI | InChI=1S/C9H7Cl2N3.C5H5N3O3/c10-6-2-1-5(3-7(6)11)8-4-13-9(12)14-8;1-7-4(3-9)2-6-5(7)8(10)11/h1-4H,(H3,12,13,14);2-3H,1H3 |
| InChIKey | PMEVIFLGORHVPO-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 132.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 383.20 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-(3,4-dichlorophenyl)-1H-imidazol-2-amine;3-methyl-2-nitroimidazole-4-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(3,4-dichlorophenyl)-1H-imidazol-2-amine;3-methyl-2-nitroimidazole-4-carbaldehyde?
The IUPAC name of 5-(3,4-dichlorophenyl)-1H-imidazol-2-amine;3-methyl-2-nitroimidazole-4-carbaldehyde (CID 88837370) is 5-(3,4-dichlorophenyl)-1H-imidazol-2-amine;3-methyl-2-nitroimidazole-4-carbaldehyde.
What is the SMILES notation for 5-(3,4-dichlorophenyl)-1H-imidazol-2-amine;3-methyl-2-nitroimidazole-4-carbaldehyde?
The canonical SMILES for 5-(3,4-dichlorophenyl)-1H-imidazol-2-amine;3-methyl-2-nitroimidazole-4-carbaldehyde is Cn1c(C=O)cnc1[N+](=O)[O-].Nc1ncc(-c2ccc(Cl)c(Cl)c2)[nH]1.
What is the InChIKey of 5-(3,4-dichlorophenyl)-1H-imidazol-2-amine;3-methyl-2-nitroimidazole-4-carbaldehyde?
The InChIKey is PMEVIFLGORHVPO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7Cl2N3.C5H5N3O3/c10-6-2-1-5(3-7(6)11)8-4-13-9(12)14-8;1-7-4(3-9)2-6-5(7)8(10)11/h1-4H,(H3,12,13,14);2-3H,1H3.
What are the key properties of 5-(3,4-dichlorophenyl)-1H-imidazol-2-amine;3-methyl-2-nitroimidazole-4-carbaldehyde?
5-(3,4-dichlorophenyl)-1H-imidazol-2-amine;3-methyl-2-nitroimidazole-4-carbaldehyde has a molecular weight of 383.20 g/mol, XLogP of 3.11, 3 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3,4-dichlorophenyl)-1H-imidazol-2-amine;3-methyl-2-nitroimidazole-4-carbaldehyde is sourced from PubChem (CID 88837370), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).