C19H24O — CID 88837876
(4Z)-4-[(2E)-3,7-dimethylocta-2,6-dien-4-ynylidene]-3,5,5-trimethylcyclohex-2-en-1-one (PubChem CID 88837876) has the molecular formula C19H24O and a molecular weight of 268.40 g/mol. Its IUPAC name is (4Z)-4-[(2E)-3,7-dimethylocta-2,6-dien-4-ynylidene]-3,5,5-trimethylcyclohex-2-en-1-one.
| Compound Name | (4Z)-4-[(2E)-3,7-dimethylocta-2,6-dien-4-ynylidene]-3,5,5-trimethylcyclohex-2-en-1-one |
|---|---|
| PubChem CID | 88837876 |
| Molecular Formula | C19H24O |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.18 |
| IUPAC Name | (4Z)-4-[(2E)-3,7-dimethylocta-2,6-dien-4-ynylidene]-3,5,5-trimethylcyclohex-2-en-1-one |
| SMILES | CC(C)=CC#C/C(C)=C/C=C1\C(C)=CC(=O)CC1(C)C |
| InChI | InChI=1S/C19H24O/c1-14(2)8-7-9-15(3)10-11-18-16(4)12-17(20)13-19(18,5)6/h8,10-12H,13H2,1-6H3/b15-10+,18-11+ |
| InChIKey | XZTGSELVBIBMBZ-MIKCAUBTSA-N |
| XLogP | 4.77 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|